C19H21F2N3O2 — CID 86998055
N-[[2-(difluoromethoxy)phenyl]methyl]-2-piperidin-1-ylpyridine-3-carboxamide (PubChem CID 86998055) has the molecular formula C19H21F2N3O2 and a molecular weight of 361.39 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)phenyl]methyl]-2-piperidin-1-ylpyridine-3-carboxamide.
| Compound Name | N-[[2-(difluoromethoxy)phenyl]methyl]-2-piperidin-1-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 86998055 |
| Molecular Formula | C19H21F2N3O2 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | N-[[2-(difluoromethoxy)phenyl]methyl]-2-piperidin-1-ylpyridine-3-carboxamide |
| SMILES | O=C(NCc1ccccc1OC(F)F)c1cccnc1N1CCCCC1 |
| InChI | InChI=1S/C19H21F2N3O2/c20-19(21)26-16-9-3-2-7-14(16)13-23-18(25)15-8-6-10-22-17(15)24-11-4-1-5-12-24/h2-3,6-10,19H,1,4-5,11-13H2,(H,23,25) |
| InChIKey | JAQLYLDMGOGGTJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |