C18H19F2N3O3 — CID 49336379
N-[[3-(difluoromethoxy)phenyl]methyl]-2-morpholin-4-ylpyridine-3-carboxamide (PubChem CID 49336379) has the molecular formula C18H19F2N3O3 and a molecular weight of 363.36 g/mol. Its IUPAC name is N-[[3-(difluoromethoxy)phenyl]methyl]-2-morpholin-4-ylpyridine-3-carboxamide.
| Compound Name | N-[[3-(difluoromethoxy)phenyl]methyl]-2-morpholin-4-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 49336379 |
| Molecular Formula | C18H19F2N3O3 |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | N-[[3-(difluoromethoxy)phenyl]methyl]-2-morpholin-4-ylpyridine-3-carboxamide |
| SMILES | O=C(NCc1cccc(OC(F)F)c1)c1cccnc1N1CCOCC1 |
| InChI | InChI=1S/C18H19F2N3O3/c19-18(20)26-14-4-1-3-13(11-14)12-22-17(24)15-5-2-6-21-16(15)23-7-9-25-10-8-23/h1-6,11,18H,7-10,12H2,(H,22,24) |
| InChIKey | UBMRXYDJMUGVJI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |