C12H18N4O2 — CID 119383590
N-(2-aminoethyl)-2-morpholin-4-ylpyridine-3-carboxamide (PubChem CID 119383590) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-morpholin-4-ylpyridine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-2-morpholin-4-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 119383590 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | N-(2-aminoethyl)-2-morpholin-4-ylpyridine-3-carboxamide |
| SMILES | NCCNC(=O)c1cccnc1N1CCOCC1 |
| InChI | InChI=1S/C12H18N4O2/c13-3-5-15-12(17)10-2-1-4-14-11(10)16-6-8-18-9-7-16/h1-2,4H,3,5-9,13H2,(H,15,17) |
| InChIKey | AUFHTYMYIUQSKD-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |