C16H15F2N3O2 — CID 154780005
N-(2,3-difluorophenyl)-2-morpholin-4-ylpyridine-3-carboxamide (PubChem CID 154780005) has the molecular formula C16H15F2N3O2 and a molecular weight of 319.31 g/mol. Its IUPAC name is N-(2,3-difluorophenyl)-2-morpholin-4-ylpyridine-3-carboxamide.
| Compound Name | N-(2,3-difluorophenyl)-2-morpholin-4-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 154780005 |
| Molecular Formula | C16H15F2N3O2 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | N-(2,3-difluorophenyl)-2-morpholin-4-ylpyridine-3-carboxamide |
| SMILES | O=C(Nc1cccc(F)c1F)c1cccnc1N1CCOCC1 |
| InChI | InChI=1S/C16H15F2N3O2/c17-12-4-1-5-13(14(12)18)20-16(22)11-3-2-6-19-15(11)21-7-9-23-10-8-21/h1-6H,7-10H2,(H,20,22) |
| InChIKey | HWIQJSIZSOBIPN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |