2-[(2,3-difluorophenyl)carbamoyl]pyridine-3-carboxylic acid

C13H8F2N2O3 — CID 63615588

IUPAC2-[(2,3-difluorophenyl)carbamoyl]pyridine-3-carboxylic acid
SMILESO=C(O)c1cccnc1C(=O)Nc1cccc(F)c1F
InChIInChI=1S/C13H8F2N2O3/c14-8-4-1-5-9(10(8)15)17-12(18)11-7(13(19)20)3-2-6-16-11/h1-6H,(H,17,18)(H,19,20)
InChIKeyFNHDKURYKMGCQC-UHFFFAOYSA-N
MW278.21 g/mol
LogP2.31
Rot. Bonds3

About 2-[(2,3-difluorophenyl)carbamoyl]pyridine-3-carboxylic acid

2-[(2,3-difluorophenyl)carbamoyl]pyridine-3-carboxylic acid (PubChem CID 63615588) has the molecular formula C13H8F2N2O3 and a molecular weight of 278.21 g/mol. Its IUPAC name is 2-[(2,3-difluorophenyl)carbamoyl]pyridine-3-carboxylic acid.

Molecular Properties

Compound Name2-[(2,3-difluorophenyl)carbamoyl]pyridine-3-carboxylic acid
PubChem CID63615588
Molecular FormulaC13H8F2N2O3
Molecular Weight278.21 g/mol
Exact Mass278.05
IUPAC Name2-[(2,3-difluorophenyl)carbamoyl]pyridine-3-carboxylic acid
SMILESO=C(O)c1cccnc1C(=O)Nc1cccc(F)c1F
InChIInChI=1S/C13H8F2N2O3/c14-8-4-1-5-9(10(8)15)17-12(18)11-7(13(19)20)3-2-6-16-11/h1-6H,(H,17,18)(H,19,20)
InChIKeyFNHDKURYKMGCQC-UHFFFAOYSA-N
XLogP2.31
TPSA79.29 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.21
LogP ≤ 52.31
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[(2,3-difluorophenyl)carbamoyl]pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,3-difluorophenyl)carbamoyl]pyridine-3-carboxylic acid?
The IUPAC name of 2-[(2,3-difluorophenyl)carbamoyl]pyridine-3-carboxylic acid (CID 63615588) is 2-[(2,3-difluorophenyl)carbamoyl]pyridine-3-carboxylic acid.
What is the SMILES notation for 2-[(2,3-difluorophenyl)carbamoyl]pyridine-3-carboxylic acid?
The canonical SMILES for 2-[(2,3-difluorophenyl)carbamoyl]pyridine-3-carboxylic acid is O=C(O)c1cccnc1C(=O)Nc1cccc(F)c1F.
What is the InChIKey of 2-[(2,3-difluorophenyl)carbamoyl]pyridine-3-carboxylic acid?
The InChIKey is FNHDKURYKMGCQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8F2N2O3/c14-8-4-1-5-9(10(8)15)17-12(18)11-7(13(19)20)3-2-6-16-11/h1-6H,(H,17,18)(H,19,20).
What are the key properties of 2-[(2,3-difluorophenyl)carbamoyl]pyridine-3-carboxylic acid?
2-[(2,3-difluorophenyl)carbamoyl]pyridine-3-carboxylic acid has a molecular weight of 278.21 g/mol, XLogP of 2.31, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,3-difluorophenyl)carbamoyl]pyridine-3-carboxylic acid is sourced from PubChem (CID 63615588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).