C19H22FN3O2S — CID 46482531
N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-morpholin-4-ylpyridine-3-carboxamide (PubChem CID 46482531) has the molecular formula C19H22FN3O2S and a molecular weight of 375.47 g/mol. Its IUPAC name is N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-morpholin-4-ylpyridine-3-carboxamide.
| Compound Name | N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-morpholin-4-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 46482531 |
| Molecular Formula | C19H22FN3O2S |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-morpholin-4-ylpyridine-3-carboxamide |
| SMILES | O=C(NCCSCc1ccccc1F)c1cccnc1N1CCOCC1 |
| InChI | InChI=1S/C19H22FN3O2S/c20-17-6-2-1-4-15(17)14-26-13-8-22-19(24)16-5-3-7-21-18(16)23-9-11-25-12-10-23/h1-7H,8-14H2,(H,22,24) |
| InChIKey | BQHXJNDTIVXOSH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|