C13H22Cl2N4O — CID 119383900
N-(2-aminoethyl)-2-piperidin-1-ylpyridine-3-carboxamide;dihydrochloride (PubChem CID 119383900) has the molecular formula C13H22Cl2N4O and a molecular weight of 321.25 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-piperidin-1-ylpyridine-3-carboxamide;dihydrochloride.
| Compound Name | N-(2-aminoethyl)-2-piperidin-1-ylpyridine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119383900 |
| Molecular Formula | C13H22Cl2N4O |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | N-(2-aminoethyl)-2-piperidin-1-ylpyridine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NCCNC(=O)c1cccnc1N1CCCCC1 |
| InChI | InChI=1S/C13H20N4O.2ClH/c14-6-8-16-13(18)11-5-4-7-15-12(11)17-9-2-1-3-10-17;;/h4-5,7H,1-3,6,8-10,14H2,(H,16,18);2*1H |
| InChIKey | GDVINKUHWOVYRN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |