C17H28Cl2N4O — CID 119535955
2-piperidin-1-yl-N-(2-pyrrolidin-3-ylethyl)pyridine-3-carboxamide;dihydrochloride (PubChem CID 119535955) has the molecular formula C17H28Cl2N4O and a molecular weight of 375.34 g/mol. Its IUPAC name is 2-piperidin-1-yl-N-(2-pyrrolidin-3-ylethyl)pyridine-3-carboxamide;dihydrochloride.
| Compound Name | 2-piperidin-1-yl-N-(2-pyrrolidin-3-ylethyl)pyridine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119535955 |
| Molecular Formula | C17H28Cl2N4O |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 2-piperidin-1-yl-N-(2-pyrrolidin-3-ylethyl)pyridine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCCC1CCNC1)c1cccnc1N1CCCCC1 |
| InChI | InChI=1S/C17H26N4O.2ClH/c22-17(20-10-7-14-6-9-18-13-14)15-5-4-8-19-16(15)21-11-2-1-3-12-21;;/h4-5,8,14,18H,1-3,6-7,9-13H2,(H,20,22);2*1H |
| InChIKey | KFMOEEHXGCHKFQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |