C18H21N3O — CID 3417086
N-(2-phenylethyl)-2-pyrrolidin-1-ylpyridine-3-carboxamide (PubChem CID 3417086) has the molecular formula C18H21N3O and a molecular weight of 295.39 g/mol. Its IUPAC name is N-(2-phenylethyl)-2-pyrrolidin-1-ylpyridine-3-carboxamide.
| Compound Name | N-(2-phenylethyl)-2-pyrrolidin-1-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 3417086 |
| Molecular Formula | C18H21N3O |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | N-(2-phenylethyl)-2-pyrrolidin-1-ylpyridine-3-carboxamide |
| SMILES | O=C(NCCc1ccccc1)c1cccnc1N1CCCC1 |
| InChI | InChI=1S/C18H21N3O/c22-18(20-12-10-15-7-2-1-3-8-15)16-9-6-11-19-17(16)21-13-4-5-14-21/h1-3,6-9,11H,4-5,10,12-14H2,(H,20,22) |
| InChIKey | MXGGFOKAKUFMDL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |