C14H11BrF2N2O2 — CID 103754084
2-bromo-N-[[2-(difluoromethoxy)phenyl]methyl]pyridine-3-carboxamide (PubChem CID 103754084) has the molecular formula C14H11BrF2N2O2 and a molecular weight of 357.15 g/mol. Its IUPAC name is 2-bromo-N-[[2-(difluoromethoxy)phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | 2-bromo-N-[[2-(difluoromethoxy)phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103754084 |
| Molecular Formula | C14H11BrF2N2O2 |
| Molecular Weight | 357.15 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | 2-bromo-N-[[2-(difluoromethoxy)phenyl]methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccccc1OC(F)F)c1cccnc1Br |
| InChI | InChI=1S/C14H11BrF2N2O2/c15-12-10(5-3-7-18-12)13(20)19-8-9-4-1-2-6-11(9)21-14(16)17/h1-7,14H,8H2,(H,19,20) |
| InChIKey | QGZSAPKINAXIGZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.15 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|