C14H12BrF2N3O3S — CID 78834052
1-[(5-bromothiophene-2-carbonyl)amino]-3-[[2-(difluoromethoxy)phenyl]methyl]urea (PubChem CID 78834052) has the molecular formula C14H12BrF2N3O3S and a molecular weight of 420.24 g/mol. Its IUPAC name is 1-[(5-bromothiophene-2-carbonyl)amino]-3-[[2-(difluoromethoxy)phenyl]methyl]urea.
| Compound Name | 1-[(5-bromothiophene-2-carbonyl)amino]-3-[[2-(difluoromethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 78834052 |
| Molecular Formula | C14H12BrF2N3O3S |
| Molecular Weight | 420.24 g/mol |
| Exact Mass | 418.98 |
| IUPAC Name | 1-[(5-bromothiophene-2-carbonyl)amino]-3-[[2-(difluoromethoxy)phenyl]methyl]urea |
| SMILES | O=C(NCc1ccccc1OC(F)F)NNC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C14H12BrF2N3O3S/c15-11-6-5-10(24-11)12(21)19-20-14(22)18-7-8-3-1-2-4-9(8)23-13(16)17/h1-6,13H,7H2,(H,19,21)(H2,18,20,22) |
| InChIKey | VZFDKWHLBILIBU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.24 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|