C19H21F2N3O3 — CID 51129432
N-benzyl-3-[[2-(difluoromethoxy)phenyl]methylcarbamoylamino]propanamide (PubChem CID 51129432) has the molecular formula C19H21F2N3O3 and a molecular weight of 377.39 g/mol. Its IUPAC name is N-benzyl-3-[[2-(difluoromethoxy)phenyl]methylcarbamoylamino]propanamide.
| Compound Name | N-benzyl-3-[[2-(difluoromethoxy)phenyl]methylcarbamoylamino]propanamide |
|---|---|
| PubChem CID | 51129432 |
| Molecular Formula | C19H21F2N3O3 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | N-benzyl-3-[[2-(difluoromethoxy)phenyl]methylcarbamoylamino]propanamide |
| SMILES | O=C(CCNC(=O)NCc1ccccc1OC(F)F)NCc1ccccc1 |
| InChI | InChI=1S/C19H21F2N3O3/c20-18(21)27-16-9-5-4-8-15(16)13-24-19(26)22-11-10-17(25)23-12-14-6-2-1-3-7-14/h1-9,18H,10-13H2,(H,23,25)(H2,22,24,26) |
| InChIKey | DLWCREOFXVMUFS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |