C15H19F2NO3 — CID 111430390
N-[[2-(difluoromethoxy)phenyl]methyl]-2-(1-hydroxycyclopentyl)acetamide (PubChem CID 111430390) has the molecular formula C15H19F2NO3 and a molecular weight of 299.32 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)phenyl]methyl]-2-(1-hydroxycyclopentyl)acetamide.
| Compound Name | N-[[2-(difluoromethoxy)phenyl]methyl]-2-(1-hydroxycyclopentyl)acetamide |
|---|---|
| PubChem CID | 111430390 |
| Molecular Formula | C15H19F2NO3 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | N-[[2-(difluoromethoxy)phenyl]methyl]-2-(1-hydroxycyclopentyl)acetamide |
| SMILES | O=C(CC1(O)CCCC1)NCc1ccccc1OC(F)F |
| InChI | InChI=1S/C15H19F2NO3/c16-14(17)21-12-6-2-1-5-11(12)10-18-13(19)9-15(20)7-3-4-8-15/h1-2,5-6,14,20H,3-4,7-10H2,(H,18,19) |
| InChIKey | UVRVVQVIGOREIU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |