C15H18F3NO3 — CID 111540945
N-[[2-(difluoromethoxy)-6-fluorophenyl]methyl]-2-(1-hydroxycyclopentyl)acetamide (PubChem CID 111540945) has the molecular formula C15H18F3NO3 and a molecular weight of 317.31 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)-6-fluorophenyl]methyl]-2-(1-hydroxycyclopentyl)acetamide.
| Compound Name | N-[[2-(difluoromethoxy)-6-fluorophenyl]methyl]-2-(1-hydroxycyclopentyl)acetamide |
|---|---|
| PubChem CID | 111540945 |
| Molecular Formula | C15H18F3NO3 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-[[2-(difluoromethoxy)-6-fluorophenyl]methyl]-2-(1-hydroxycyclopentyl)acetamide |
| SMILES | O=C(CC1(O)CCCC1)NCc1c(F)cccc1OC(F)F |
| InChI | InChI=1S/C15H18F3NO3/c16-11-4-3-5-12(22-14(17)18)10(11)9-19-13(20)8-15(21)6-1-2-7-15/h3-5,14,21H,1-2,6-9H2,(H,19,20) |
| InChIKey | MQZOSSLOLOLOQB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |