C12H15F3N2O3 — CID 111509592
1-[[2-(difluoromethoxy)-6-fluorophenyl]methyl]-3-(3-hydroxypropyl)urea (PubChem CID 111509592) has the molecular formula C12H15F3N2O3 and a molecular weight of 292.26 g/mol. Its IUPAC name is 1-[[2-(difluoromethoxy)-6-fluorophenyl]methyl]-3-(3-hydroxypropyl)urea.
| Compound Name | 1-[[2-(difluoromethoxy)-6-fluorophenyl]methyl]-3-(3-hydroxypropyl)urea |
|---|---|
| PubChem CID | 111509592 |
| Molecular Formula | C12H15F3N2O3 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 1-[[2-(difluoromethoxy)-6-fluorophenyl]methyl]-3-(3-hydroxypropyl)urea |
| SMILES | O=C(NCCCO)NCc1c(F)cccc1OC(F)F |
| InChI | InChI=1S/C12H15F3N2O3/c13-9-3-1-4-10(20-11(14)15)8(9)7-17-12(19)16-5-2-6-18/h1,3-4,11,18H,2,5-7H2,(H2,16,17,19) |
| InChIKey | WLZSDLVCFCWTDY-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|