C12H10F3N3O2 — CID 71985919
N-[[2-(difluoromethoxy)-6-fluorophenyl]methyl]-1H-pyrazole-5-carboxamide (PubChem CID 71985919) has the molecular formula C12H10F3N3O2 and a molecular weight of 285.22 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)-6-fluorophenyl]methyl]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[[2-(difluoromethoxy)-6-fluorophenyl]methyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 71985919 |
| Molecular Formula | C12H10F3N3O2 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | N-[[2-(difluoromethoxy)-6-fluorophenyl]methyl]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NCc1c(F)cccc1OC(F)F)c1ccn[nH]1 |
| InChI | InChI=1S/C12H10F3N3O2/c13-8-2-1-3-10(20-12(14)15)7(8)6-16-11(19)9-4-5-17-18-9/h1-5,12H,6H2,(H,16,19)(H,17,18) |
| InChIKey | PBIISMOSBFKLAV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |