C13H10F3NO3 — CID 71985921
N-[[2-(difluoromethoxy)-6-fluorophenyl]methyl]furan-3-carboxamide (PubChem CID 71985921) has the molecular formula C13H10F3NO3 and a molecular weight of 285.22 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)-6-fluorophenyl]methyl]furan-3-carboxamide.
| Compound Name | N-[[2-(difluoromethoxy)-6-fluorophenyl]methyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 71985921 |
| Molecular Formula | C13H10F3NO3 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | N-[[2-(difluoromethoxy)-6-fluorophenyl]methyl]furan-3-carboxamide |
| SMILES | O=C(NCc1c(F)cccc1OC(F)F)c1ccoc1 |
| InChI | InChI=1S/C13H10F3NO3/c14-10-2-1-3-11(20-13(15)16)9(10)6-17-12(18)8-4-5-19-7-8/h1-5,7,13H,6H2,(H,17,18) |
| InChIKey | NHRSZZHGAWUWAY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |