C15H16FNO3 — CID 71979262
N-[2-(2-fluorophenoxy)butyl]furan-3-carboxamide (PubChem CID 71979262) has the molecular formula C15H16FNO3 and a molecular weight of 277.30 g/mol. Its IUPAC name is N-[2-(2-fluorophenoxy)butyl]furan-3-carboxamide.
| Compound Name | N-[2-(2-fluorophenoxy)butyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 71979262 |
| Molecular Formula | C15H16FNO3 |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | N-[2-(2-fluorophenoxy)butyl]furan-3-carboxamide |
| SMILES | CCC(CNC(=O)c1ccoc1)Oc1ccccc1F |
| InChI | InChI=1S/C15H16FNO3/c1-2-12(20-14-6-4-3-5-13(14)16)9-17-15(18)11-7-8-19-10-11/h3-8,10,12H,2,9H2,1H3,(H,17,18) |
| InChIKey | UHZUIGLAMBDTCC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |