C16H23FN2O3 — CID 97025731
(3R)-N-[(2R)-2-(2-fluorophenoxy)butyl]-3-hydroxypiperidine-1-carboxamide (PubChem CID 97025731) has the molecular formula C16H23FN2O3 and a molecular weight of 310.37 g/mol. Its IUPAC name is (3R)-N-[(2R)-2-(2-fluorophenoxy)butyl]-3-hydroxypiperidine-1-carboxamide.
| Compound Name | (3R)-N-[(2R)-2-(2-fluorophenoxy)butyl]-3-hydroxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 97025731 |
| Molecular Formula | C16H23FN2O3 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (3R)-N-[(2R)-2-(2-fluorophenoxy)butyl]-3-hydroxypiperidine-1-carboxamide |
| SMILES | CC[C@H](CNC(=O)N1CCC[C@@H](O)C1)Oc1ccccc1F |
| InChI | InChI=1S/C16H23FN2O3/c1-2-13(22-15-8-4-3-7-14(15)17)10-18-16(21)19-9-5-6-12(20)11-19/h3-4,7-8,12-13,20H,2,5-6,9-11H2,1H3,(H,18,21)/t12-,13-/m1/s1 |
| InChIKey | XVRVRJCQKLIJNY-CHWSQXEVSA-N |
| XLogP | 2.15 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |