C14H18F2N2O3 — CID 110895568
N-[[2-(difluoromethoxy)phenyl]methyl]-3-hydroxypiperidine-1-carboxamide (PubChem CID 110895568) has the molecular formula C14H18F2N2O3 and a molecular weight of 300.30 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)phenyl]methyl]-3-hydroxypiperidine-1-carboxamide.
| Compound Name | N-[[2-(difluoromethoxy)phenyl]methyl]-3-hydroxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 110895568 |
| Molecular Formula | C14H18F2N2O3 |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | N-[[2-(difluoromethoxy)phenyl]methyl]-3-hydroxypiperidine-1-carboxamide |
| SMILES | O=C(NCc1ccccc1OC(F)F)N1CCCC(O)C1 |
| InChI | InChI=1S/C14H18F2N2O3/c15-13(16)21-12-6-2-1-4-10(12)8-17-14(20)18-7-3-5-11(19)9-18/h1-2,4,6,11,13,19H,3,5,7-9H2,(H,17,20) |
| InChIKey | MZWJWNHGCJREEB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |