C18H26FN3O2 — CID 95968686
(3R)-N-[(2R)-2-(2-fluorophenoxy)propyl]-3-pyrrolidin-1-ylpyrrolidine-1-carboxamide (PubChem CID 95968686) has the molecular formula C18H26FN3O2 and a molecular weight of 335.42 g/mol. Its IUPAC name is (3R)-N-[(2R)-2-(2-fluorophenoxy)propyl]-3-pyrrolidin-1-ylpyrrolidine-1-carboxamide.
| Compound Name | (3R)-N-[(2R)-2-(2-fluorophenoxy)propyl]-3-pyrrolidin-1-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 95968686 |
| Molecular Formula | C18H26FN3O2 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | (3R)-N-[(2R)-2-(2-fluorophenoxy)propyl]-3-pyrrolidin-1-ylpyrrolidine-1-carboxamide |
| SMILES | C[C@H](CNC(=O)N1CC[C@@H](N2CCCC2)C1)Oc1ccccc1F |
| InChI | InChI=1S/C18H26FN3O2/c1-14(24-17-7-3-2-6-16(17)19)12-20-18(23)22-11-8-15(13-22)21-9-4-5-10-21/h2-3,6-7,14-15H,4-5,8-13H2,1H3,(H,20,23)/t14-,15-/m1/s1 |
| InChIKey | YNNXTDIVPLWCLZ-HUUCEWRRSA-N |
| XLogP | 2.47 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |