C17H23ClFN3O — CID 125130031
(3R)-N-[(2-chloro-6-fluorophenyl)methyl]-3-piperidin-1-ylpyrrolidine-1-carboxamide (PubChem CID 125130031) has the molecular formula C17H23ClFN3O and a molecular weight of 339.84 g/mol. Its IUPAC name is (3R)-N-[(2-chloro-6-fluorophenyl)methyl]-3-piperidin-1-ylpyrrolidine-1-carboxamide.
| Compound Name | (3R)-N-[(2-chloro-6-fluorophenyl)methyl]-3-piperidin-1-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 125130031 |
| Molecular Formula | C17H23ClFN3O |
| Molecular Weight | 339.84 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | (3R)-N-[(2-chloro-6-fluorophenyl)methyl]-3-piperidin-1-ylpyrrolidine-1-carboxamide |
| SMILES | O=C(NCc1c(F)cccc1Cl)N1CC[C@@H](N2CCCCC2)C1 |
| InChI | InChI=1S/C17H23ClFN3O/c18-15-5-4-6-16(19)14(15)11-20-17(23)22-10-7-13(12-22)21-8-2-1-3-9-21/h4-6,13H,1-3,7-12H2,(H,20,23)/t13-/m1/s1 |
| InChIKey | DCEKAMSCELDEJF-CYBMUJFWSA-N |
| XLogP | 3.25 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.84 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |