C14H14ClFN4O — CID 124761260
2-(2-chloro-6-fluorophenyl)-1-[(3S)-3-(triazol-2-yl)pyrrolidin-1-yl]ethanone (PubChem CID 124761260) has the molecular formula C14H14ClFN4O and a molecular weight of 308.74 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-1-[(3S)-3-(triazol-2-yl)pyrrolidin-1-yl]ethanone.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-1-[(3S)-3-(triazol-2-yl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 124761260 |
| Molecular Formula | C14H14ClFN4O |
| Molecular Weight | 308.74 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-1-[(3S)-3-(triazol-2-yl)pyrrolidin-1-yl]ethanone |
| SMILES | O=C(Cc1c(F)cccc1Cl)N1CC[C@H](n2nccn2)C1 |
| InChI | InChI=1S/C14H14ClFN4O/c15-12-2-1-3-13(16)11(12)8-14(21)19-7-4-10(9-19)20-17-5-6-18-20/h1-3,5-6,10H,4,7-9H2/t10-/m0/s1 |
| InChIKey | XUEKRICFNFNXLO-JTQLQIEISA-N |
| XLogP | 2.09 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.74 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |