C15H15ClFN3O3 — CID 121159909
3-[1-[2-(2-chloro-6-fluorophenyl)acetyl]pyrrolidin-3-yl]imidazolidine-2,4-dione (PubChem CID 121159909) has the molecular formula C15H15ClFN3O3 and a molecular weight of 339.75 g/mol. Its IUPAC name is 3-[1-[2-(2-chloro-6-fluorophenyl)acetyl]pyrrolidin-3-yl]imidazolidine-2,4-dione.
| Compound Name | 3-[1-[2-(2-chloro-6-fluorophenyl)acetyl]pyrrolidin-3-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 121159909 |
| Molecular Formula | C15H15ClFN3O3 |
| Molecular Weight | 339.75 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 3-[1-[2-(2-chloro-6-fluorophenyl)acetyl]pyrrolidin-3-yl]imidazolidine-2,4-dione |
| SMILES | O=C(Cc1c(F)cccc1Cl)N1CCC(N2C(=O)CNC2=O)C1 |
| InChI | InChI=1S/C15H15ClFN3O3/c16-11-2-1-3-12(17)10(11)6-13(21)19-5-4-9(8-19)20-14(22)7-18-15(20)23/h1-3,9H,4-8H2,(H,18,23) |
| InChIKey | QRDPRXYOBWIXAU-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.75 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|