C13H16N4O3 — CID 121159893
3-[1-(2-pyrrol-1-ylacetyl)pyrrolidin-3-yl]imidazolidine-2,4-dione (PubChem CID 121159893) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is 3-[1-(2-pyrrol-1-ylacetyl)pyrrolidin-3-yl]imidazolidine-2,4-dione.
| Compound Name | 3-[1-(2-pyrrol-1-ylacetyl)pyrrolidin-3-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 121159893 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 3-[1-(2-pyrrol-1-ylacetyl)pyrrolidin-3-yl]imidazolidine-2,4-dione |
| SMILES | O=C(Cn1cccc1)N1CCC(N2C(=O)CNC2=O)C1 |
| InChI | InChI=1S/C13H16N4O3/c18-11-7-14-13(20)17(11)10-3-6-16(8-10)12(19)9-15-4-1-2-5-15/h1-2,4-5,10H,3,6-9H2,(H,14,20) |
| InChIKey | UETVXNLCQPKXCU-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|