C17H20N4O5 — CID 121159977
benzyl N-[2-[3-(2,5-dioxoimidazolidin-1-yl)pyrrolidin-1-yl]-2-oxoethyl]carbamate (PubChem CID 121159977) has the molecular formula C17H20N4O5 and a molecular weight of 360.37 g/mol. Its IUPAC name is benzyl N-[2-[3-(2,5-dioxoimidazolidin-1-yl)pyrrolidin-1-yl]-2-oxoethyl]carbamate.
| Compound Name | benzyl N-[2-[3-(2,5-dioxoimidazolidin-1-yl)pyrrolidin-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 121159977 |
| Molecular Formula | C17H20N4O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | benzyl N-[2-[3-(2,5-dioxoimidazolidin-1-yl)pyrrolidin-1-yl]-2-oxoethyl]carbamate |
| SMILES | O=C(NCC(=O)N1CCC(N2C(=O)CNC2=O)C1)OCc1ccccc1 |
| InChI | InChI=1S/C17H20N4O5/c22-14(8-19-17(25)26-11-12-4-2-1-3-5-12)20-7-6-13(10-20)21-15(23)9-18-16(21)24/h1-5,13H,6-11H2,(H,18,24)(H,19,25) |
| InChIKey | HCXPNQRSGHGLRN-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|