C24H28N2O5 — CID 71266022
methyl 2-[4-[1-[2-(phenylmethoxycarbonylamino)acetyl]piperidin-4-yl]phenyl]acetate (PubChem CID 71266022) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is methyl 2-[4-[1-[2-(phenylmethoxycarbonylamino)acetyl]piperidin-4-yl]phenyl]acetate.
| Compound Name | methyl 2-[4-[1-[2-(phenylmethoxycarbonylamino)acetyl]piperidin-4-yl]phenyl]acetate |
|---|---|
| PubChem CID | 71266022 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | methyl 2-[4-[1-[2-(phenylmethoxycarbonylamino)acetyl]piperidin-4-yl]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(C2CCN(C(=O)CNC(=O)OCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H28N2O5/c1-30-23(28)15-18-7-9-20(10-8-18)21-11-13-26(14-12-21)22(27)16-25-24(29)31-17-19-5-3-2-4-6-19/h2-10,21H,11-17H2,1H3,(H,25,29) |
| InChIKey | SXQUQCZABXOZDH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |