C27H33NO5 — CID 123452110
2-[4-[1-(4-phenylmethoxycarbonylhexanoyl)piperidin-4-yl]phenyl]acetic acid (PubChem CID 123452110) has the molecular formula C27H33NO5 and a molecular weight of 451.56 g/mol. Its IUPAC name is 2-[4-[1-(4-phenylmethoxycarbonylhexanoyl)piperidin-4-yl]phenyl]acetic acid.
| Compound Name | 2-[4-[1-(4-phenylmethoxycarbonylhexanoyl)piperidin-4-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 123452110 |
| Molecular Formula | C27H33NO5 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 2-[4-[1-(4-phenylmethoxycarbonylhexanoyl)piperidin-4-yl]phenyl]acetic acid |
| SMILES | CCC(CCC(=O)N1CCC(c2ccc(CC(=O)O)cc2)CC1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H33NO5/c1-2-22(27(32)33-19-21-6-4-3-5-7-21)12-13-25(29)28-16-14-24(15-17-28)23-10-8-20(9-11-23)18-26(30)31/h3-11,22,24H,2,12-19H2,1H3,(H,30,31) |
| InChIKey | BNAPQDMNKRJXLU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |