C17H21NO4 — CID 166000959
2-[4-(1-prop-2-enoxycarbonylpiperidin-4-yl)phenyl]acetic acid (PubChem CID 166000959) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-[4-(1-prop-2-enoxycarbonylpiperidin-4-yl)phenyl]acetic acid.
| Compound Name | 2-[4-(1-prop-2-enoxycarbonylpiperidin-4-yl)phenyl]acetic acid |
|---|---|
| PubChem CID | 166000959 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 2-[4-(1-prop-2-enoxycarbonylpiperidin-4-yl)phenyl]acetic acid |
| SMILES | C=CCOC(=O)N1CCC(c2ccc(CC(=O)O)cc2)CC1 |
| InChI | InChI=1S/C17H21NO4/c1-2-11-22-17(21)18-9-7-15(8-10-18)14-5-3-13(4-6-14)12-16(19)20/h2-6,15H,1,7-12H2,(H,19,20) |
| InChIKey | NLZWMPBGFPHUGT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|