C12H19NO5 — CID 66870234
3-[(3R,4S)-3-hydroxy-1-prop-2-enoxycarbonylpiperidin-4-yl]propanoic acid (PubChem CID 66870234) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is 3-[(3R,4S)-3-hydroxy-1-prop-2-enoxycarbonylpiperidin-4-yl]propanoic acid.
| Compound Name | 3-[(3R,4S)-3-hydroxy-1-prop-2-enoxycarbonylpiperidin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 66870234 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 3-[(3R,4S)-3-hydroxy-1-prop-2-enoxycarbonylpiperidin-4-yl]propanoic acid |
| SMILES | C=CCOC(=O)N1CC[C@H](CCC(=O)O)[C@@H](O)C1 |
| InChI | InChI=1S/C12H19NO5/c1-2-7-18-12(17)13-6-5-9(10(14)8-13)3-4-11(15)16/h2,9-10,14H,1,3-8H2,(H,15,16)/t9-,10-/m0/s1 |
| InChIKey | MVLNNGHIGCQRDV-UWVGGRQHSA-N |
| XLogP | 0.86 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|