C10H15BrN2O3 — CID 67597256
prop-2-enyl 3-[(2-bromoacetyl)amino]pyrrolidine-1-carboxylate (PubChem CID 67597256) has the molecular formula C10H15BrN2O3 and a molecular weight of 291.15 g/mol. Its IUPAC name is prop-2-enyl 3-[(2-bromoacetyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl 3-[(2-bromoacetyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67597256 |
| Molecular Formula | C10H15BrN2O3 |
| Molecular Weight | 291.15 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | prop-2-enyl 3-[(2-bromoacetyl)amino]pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CCC(NC(=O)CBr)C1 |
| InChI | InChI=1S/C10H15BrN2O3/c1-2-5-16-10(15)13-4-3-8(7-13)12-9(14)6-11/h2,8H,1,3-7H2,(H,12,14) |
| InChIKey | KHDOUXPJWRZGRY-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.15 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|