C18H23NO4 — CID 167722036
3-phenyl-3-(1-prop-2-enoxycarbonylpiperidin-4-yl)propanoic acid (PubChem CID 167722036) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is 3-phenyl-3-(1-prop-2-enoxycarbonylpiperidin-4-yl)propanoic acid.
| Compound Name | 3-phenyl-3-(1-prop-2-enoxycarbonylpiperidin-4-yl)propanoic acid |
|---|---|
| PubChem CID | 167722036 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 3-phenyl-3-(1-prop-2-enoxycarbonylpiperidin-4-yl)propanoic acid |
| SMILES | C=CCOC(=O)N1CCC(C(CC(=O)O)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H23NO4/c1-2-12-23-18(22)19-10-8-15(9-11-19)16(13-17(20)21)14-6-4-3-5-7-14/h2-7,15-16H,1,8-13H2,(H,20,21) |
| InChIKey | KIBTWNDJCGPJKX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|