C20H24ClN3O — CID 97278731
(3S)-N-(4-chloronaphthalen-1-yl)-3-piperidin-1-ylpyrrolidine-1-carboxamide (PubChem CID 97278731) has the molecular formula C20H24ClN3O and a molecular weight of 357.88 g/mol. Its IUPAC name is (3S)-N-(4-chloronaphthalen-1-yl)-3-piperidin-1-ylpyrrolidine-1-carboxamide.
| Compound Name | (3S)-N-(4-chloronaphthalen-1-yl)-3-piperidin-1-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 97278731 |
| Molecular Formula | C20H24ClN3O |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | (3S)-N-(4-chloronaphthalen-1-yl)-3-piperidin-1-ylpyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c2ccccc12)N1CC[C@H](N2CCCCC2)C1 |
| InChI | InChI=1S/C20H24ClN3O/c21-18-8-9-19(17-7-3-2-6-16(17)18)22-20(25)24-13-10-15(14-24)23-11-4-1-5-12-23/h2-3,6-9,15H,1,4-5,10-14H2,(H,22,25)/t15-/m0/s1 |
| InChIKey | DDNXLPPNEBFNTJ-HNNXBMFYSA-N |
| XLogP | 4.59 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |