C15H20FNO3 — CID 95972631
(3R)-N-[(2S)-2-(2-fluorophenoxy)butyl]oxolane-3-carboxamide (PubChem CID 95972631) has the molecular formula C15H20FNO3 and a molecular weight of 281.33 g/mol. Its IUPAC name is (3R)-N-[(2S)-2-(2-fluorophenoxy)butyl]oxolane-3-carboxamide.
| Compound Name | (3R)-N-[(2S)-2-(2-fluorophenoxy)butyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 95972631 |
| Molecular Formula | C15H20FNO3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (3R)-N-[(2S)-2-(2-fluorophenoxy)butyl]oxolane-3-carboxamide |
| SMILES | CC[C@@H](CNC(=O)[C@@H]1CCOC1)Oc1ccccc1F |
| InChI | InChI=1S/C15H20FNO3/c1-2-12(20-14-6-4-3-5-13(14)16)9-17-15(18)11-7-8-19-10-11/h3-6,11-12H,2,7-10H2,1H3,(H,17,18)/t11-,12+/m1/s1 |
| InChIKey | FSVUBHGYNGDBTC-NEPJUHHUSA-N |
| XLogP | 2.14 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |