C19H20FNO5 — CID 119187039
2-[3-[2-(2-fluorophenoxy)butylcarbamoyl]phenoxy]acetic acid (PubChem CID 119187039) has the molecular formula C19H20FNO5 and a molecular weight of 361.37 g/mol. Its IUPAC name is 2-[3-[2-(2-fluorophenoxy)butylcarbamoyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[2-(2-fluorophenoxy)butylcarbamoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 119187039 |
| Molecular Formula | C19H20FNO5 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 2-[3-[2-(2-fluorophenoxy)butylcarbamoyl]phenoxy]acetic acid |
| SMILES | CCC(CNC(=O)c1cccc(OCC(=O)O)c1)Oc1ccccc1F |
| InChI | InChI=1S/C19H20FNO5/c1-2-14(26-17-9-4-3-8-16(17)20)11-21-19(24)13-6-5-7-15(10-13)25-12-18(22)23/h3-10,14H,2,11-12H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | DTIWVGXKGZDGPA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |