C10H11F2NO2 — CID 5203738
2,6-difluoro-N-(3-hydroxypropyl)benzamide (PubChem CID 5203738) has the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. Its IUPAC name is 2,6-difluoro-N-(3-hydroxypropyl)benzamide.
| Compound Name | 2,6-difluoro-N-(3-hydroxypropyl)benzamide |
|---|---|
| PubChem CID | 5203738 |
| Molecular Formula | C10H11F2NO2 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 2,6-difluoro-N-(3-hydroxypropyl)benzamide |
| SMILES | O=C(NCCCO)c1c(F)cccc1F |
| InChI | InChI=1S/C10H11F2NO2/c11-7-3-1-4-8(12)9(7)10(15)13-5-2-6-14/h1,3-4,14H,2,5-6H2,(H,13,15) |
| InChIKey | YQNSEBCRIUUJND-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|