C15H20F2N2O3 — CID 97012243
2,6-difluoro-N-[(2R)-1-(3-hydroxypropylamino)-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 97012243) has the molecular formula C15H20F2N2O3 and a molecular weight of 314.33 g/mol. Its IUPAC name is 2,6-difluoro-N-[(2R)-1-(3-hydroxypropylamino)-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 2,6-difluoro-N-[(2R)-1-(3-hydroxypropylamino)-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 97012243 |
| Molecular Formula | C15H20F2N2O3 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 2,6-difluoro-N-[(2R)-1-(3-hydroxypropylamino)-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)[C@@H](NC(=O)c1c(F)cccc1F)C(=O)NCCCO |
| InChI | InChI=1S/C15H20F2N2O3/c1-9(2)13(15(22)18-7-4-8-20)19-14(21)12-10(16)5-3-6-11(12)17/h3,5-6,9,13,20H,4,7-8H2,1-2H3,(H,18,22)(H,19,21)/t13-/m1/s1 |
| InChIKey | YWHOTRKUEQTWGE-CYBMUJFWSA-N |
| XLogP | 1.22 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|