C17H22F2N2O4 — CID 119234490
5-[[2-[(2,6-difluorobenzoyl)amino]-3-methylbutanoyl]amino]pentanoic acid (PubChem CID 119234490) has the molecular formula C17H22F2N2O4 and a molecular weight of 356.37 g/mol. Its IUPAC name is 5-[[2-[(2,6-difluorobenzoyl)amino]-3-methylbutanoyl]amino]pentanoic acid.
| Compound Name | 5-[[2-[(2,6-difluorobenzoyl)amino]-3-methylbutanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119234490 |
| Molecular Formula | C17H22F2N2O4 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 5-[[2-[(2,6-difluorobenzoyl)amino]-3-methylbutanoyl]amino]pentanoic acid |
| SMILES | CC(C)C(NC(=O)c1c(F)cccc1F)C(=O)NCCCCC(=O)O |
| InChI | InChI=1S/C17H22F2N2O4/c1-10(2)15(17(25)20-9-4-3-8-13(22)23)21-16(24)14-11(18)6-5-7-12(14)19/h5-7,10,15H,3-4,8-9H2,1-2H3,(H,20,25)(H,21,24)(H,22,23) |
| InChIKey | CEQJXFMDUPQCBD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|