C16H24ClF2N3O2 — CID 119508620
N-[1-[2-(ethylamino)ethylamino]-3-methyl-1-oxobutan-2-yl]-2,6-difluorobenzamide;hydrochloride (PubChem CID 119508620) has the molecular formula C16H24ClF2N3O2 and a molecular weight of 363.84 g/mol. Its IUPAC name is N-[1-[2-(ethylamino)ethylamino]-3-methyl-1-oxobutan-2-yl]-2,6-difluorobenzamide;hydrochloride.
| Compound Name | N-[1-[2-(ethylamino)ethylamino]-3-methyl-1-oxobutan-2-yl]-2,6-difluorobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119508620 |
| Molecular Formula | C16H24ClF2N3O2 |
| Molecular Weight | 363.84 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | N-[1-[2-(ethylamino)ethylamino]-3-methyl-1-oxobutan-2-yl]-2,6-difluorobenzamide;hydrochloride |
| SMILES | CCNCCNC(=O)C(NC(=O)c1c(F)cccc1F)C(C)C.Cl |
| InChI | InChI=1S/C16H23F2N3O2.ClH/c1-4-19-8-9-20-16(23)14(10(2)3)21-15(22)13-11(17)6-5-7-12(13)18;/h5-7,10,14,19H,4,8-9H2,1-3H3,(H,20,23)(H,21,22);1H |
| InChIKey | NUFVZSMVQHLCMA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.84 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|