C12H14BrF2NO — CID 106130576
N-(4-bromopentyl)-2,6-difluorobenzamide (PubChem CID 106130576) has the molecular formula C12H14BrF2NO and a molecular weight of 306.15 g/mol. Its IUPAC name is N-(4-bromopentyl)-2,6-difluorobenzamide.
| Compound Name | N-(4-bromopentyl)-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 106130576 |
| Molecular Formula | C12H14BrF2NO |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | N-(4-bromopentyl)-2,6-difluorobenzamide |
| SMILES | CC(Br)CCCNC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C12H14BrF2NO/c1-8(13)4-3-7-16-12(17)11-9(14)5-2-6-10(11)15/h2,5-6,8H,3-4,7H2,1H3,(H,16,17) |
| InChIKey | UGAHGIORHKRLMA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|