C20H24F2N2O3 — CID 55912713
1-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-[(2-propan-2-yloxyphenyl)methyl]urea (PubChem CID 55912713) has the molecular formula C20H24F2N2O3 and a molecular weight of 378.42 g/mol. Its IUPAC name is 1-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-[(2-propan-2-yloxyphenyl)methyl]urea.
| Compound Name | 1-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-[(2-propan-2-yloxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 55912713 |
| Molecular Formula | C20H24F2N2O3 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 1-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-[(2-propan-2-yloxyphenyl)methyl]urea |
| SMILES | CC(C)Oc1ccccc1CNC(=O)NCCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C20H24F2N2O3/c1-14(2)26-18-6-4-3-5-16(18)13-24-20(25)23-12-11-15-7-9-17(10-8-15)27-19(21)22/h3-10,14,19H,11-13H2,1-2H3,(H2,23,24,25) |
| InChIKey | WSGMYVCRAIWFNH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |