C11H15F2N3O2 — CID 83109474
2-[[2-(difluoromethoxy)phenyl]methylamino]ethylurea (PubChem CID 83109474) has the molecular formula C11H15F2N3O2 and a molecular weight of 259.26 g/mol. Its IUPAC name is 2-[[2-(difluoromethoxy)phenyl]methylamino]ethylurea.
| Compound Name | 2-[[2-(difluoromethoxy)phenyl]methylamino]ethylurea |
|---|---|
| PubChem CID | 83109474 |
| Molecular Formula | C11H15F2N3O2 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 2-[[2-(difluoromethoxy)phenyl]methylamino]ethylurea |
| SMILES | NC(=O)NCCNCc1ccccc1OC(F)F |
| InChI | InChI=1S/C11H15F2N3O2/c12-10(13)18-9-4-2-1-3-8(9)7-15-5-6-16-11(14)17/h1-4,10,15H,5-7H2,(H3,14,16,17) |
| InChIKey | AUVYPXMQRZRVNY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|