C11H15F2NO2 — CID 93033134
(2R)-1-[[2-(difluoromethoxy)phenyl]methylamino]propan-2-ol (PubChem CID 93033134) has the molecular formula C11H15F2NO2 and a molecular weight of 231.24 g/mol. Its IUPAC name is (2R)-1-[[2-(difluoromethoxy)phenyl]methylamino]propan-2-ol.
| Compound Name | (2R)-1-[[2-(difluoromethoxy)phenyl]methylamino]propan-2-ol |
|---|---|
| PubChem CID | 93033134 |
| Molecular Formula | C11H15F2NO2 |
| Molecular Weight | 231.24 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | (2R)-1-[[2-(difluoromethoxy)phenyl]methylamino]propan-2-ol |
| SMILES | C[C@@H](O)CNCc1ccccc1OC(F)F |
| InChI | InChI=1S/C11H15F2NO2/c1-8(15)6-14-7-9-4-2-3-5-10(9)16-11(12)13/h2-5,8,11,14-15H,6-7H2,1H3/t8-/m1/s1 |
| InChIKey | IJBIFUKSVNSUHU-MRVPVSSYSA-N |
| XLogP | 1.76 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |