C9H11F2NO2 — CID 115280691
1-[2-(difluoromethoxy)phenyl]-N-methoxymethanamine (PubChem CID 115280691) has the molecular formula C9H11F2NO2 and a molecular weight of 203.19 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)phenyl]-N-methoxymethanamine.
| Compound Name | 1-[2-(difluoromethoxy)phenyl]-N-methoxymethanamine |
|---|---|
| PubChem CID | 115280691 |
| Molecular Formula | C9H11F2NO2 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 1-[2-(difluoromethoxy)phenyl]-N-methoxymethanamine |
| SMILES | CONCc1ccccc1OC(F)F |
| InChI | InChI=1S/C9H11F2NO2/c1-13-12-6-7-4-2-3-5-8(7)14-9(10)11/h2-5,9,12H,6H2,1H3 |
| InChIKey | LIMGHYUZNMHJJX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|