C13H17F2NO — CID 43298345
1-cyclobutyl-N-[[2-(difluoromethoxy)phenyl]methyl]methanamine (PubChem CID 43298345) has the molecular formula C13H17F2NO and a molecular weight of 241.28 g/mol. Its IUPAC name is 1-cyclobutyl-N-[[2-(difluoromethoxy)phenyl]methyl]methanamine.
| Compound Name | 1-cyclobutyl-N-[[2-(difluoromethoxy)phenyl]methyl]methanamine |
|---|---|
| PubChem CID | 43298345 |
| Molecular Formula | C13H17F2NO |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 1-cyclobutyl-N-[[2-(difluoromethoxy)phenyl]methyl]methanamine |
| SMILES | FC(F)Oc1ccccc1CNCC1CCC1 |
| InChI | InChI=1S/C13H17F2NO/c14-13(15)17-12-7-2-1-6-11(12)9-16-8-10-4-3-5-10/h1-2,6-7,10,13,16H,3-5,8-9H2 |
| InChIKey | YVSRLZAPNBMSFF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |