C12H17F2NO2S — CID 115763988
N-[[2-(difluoromethoxy)phenyl]methyl]-2-methylsulfinylpropan-1-amine (PubChem CID 115763988) has the molecular formula C12H17F2NO2S and a molecular weight of 277.34 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)phenyl]methyl]-2-methylsulfinylpropan-1-amine.
| Compound Name | N-[[2-(difluoromethoxy)phenyl]methyl]-2-methylsulfinylpropan-1-amine |
|---|---|
| PubChem CID | 115763988 |
| Molecular Formula | C12H17F2NO2S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | N-[[2-(difluoromethoxy)phenyl]methyl]-2-methylsulfinylpropan-1-amine |
| SMILES | CC(CNCc1ccccc1OC(F)F)S(C)=O |
| InChI | InChI=1S/C12H17F2NO2S/c1-9(18(2)16)7-15-8-10-5-3-4-6-11(10)17-12(13)14/h3-6,9,12,15H,7-8H2,1-2H3 |
| InChIKey | NAUKXPDYDPFZFD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |