C14H14BrNO3S — CID 55594760
5-bromo-N-[(2,3-dimethoxyphenyl)methyl]thiophene-2-carboxamide (PubChem CID 55594760) has the molecular formula C14H14BrNO3S and a molecular weight of 356.24 g/mol. Its IUPAC name is 5-bromo-N-[(2,3-dimethoxyphenyl)methyl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[(2,3-dimethoxyphenyl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55594760 |
| Molecular Formula | C14H14BrNO3S |
| Molecular Weight | 356.24 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | 5-bromo-N-[(2,3-dimethoxyphenyl)methyl]thiophene-2-carboxamide |
| SMILES | COc1cccc(CNC(=O)c2ccc(Br)s2)c1OC |
| InChI | InChI=1S/C14H14BrNO3S/c1-18-10-5-3-4-9(13(10)19-2)8-16-14(17)11-6-7-12(15)20-11/h3-7H,8H2,1-2H3,(H,16,17) |
| InChIKey | YNYFQXIJMNRTGG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.24 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |