C15H16BrNO4S — CID 32775718
N-[(5-bromothiophen-2-yl)methyl]-2,3,4-trimethoxybenzamide (PubChem CID 32775718) has the molecular formula C15H16BrNO4S and a molecular weight of 386.27 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-2,3,4-trimethoxybenzamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-2,3,4-trimethoxybenzamide |
|---|---|
| PubChem CID | 32775718 |
| Molecular Formula | C15H16BrNO4S |
| Molecular Weight | 386.27 g/mol |
| Exact Mass | 385.00 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-2,3,4-trimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCc2ccc(Br)s2)c(OC)c1OC |
| InChI | InChI=1S/C15H16BrNO4S/c1-19-11-6-5-10(13(20-2)14(11)21-3)15(18)17-8-9-4-7-12(16)22-9/h4-7H,8H2,1-3H3,(H,17,18) |
| InChIKey | NFMIPYYMPGBRSG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |