C16H17BrN2O6S — CID 33171938
N-[(5-bromothiophen-2-yl)methyl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide (PubChem CID 33171938) has the molecular formula C16H17BrN2O6S and a molecular weight of 445.29 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide |
|---|---|
| PubChem CID | 33171938 |
| Molecular Formula | C16H17BrN2O6S |
| Molecular Weight | 445.29 g/mol |
| Exact Mass | 444.00 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide |
| SMILES | COCCOc1cc([N+](=O)[O-])c(C(=O)NCc2ccc(Br)s2)cc1OC |
| InChI | InChI=1S/C16H17BrN2O6S/c1-23-5-6-25-14-8-12(19(21)22)11(7-13(14)24-2)16(20)18-9-10-3-4-15(17)26-10/h3-4,7-8H,5-6,9H2,1-2H3,(H,18,20) |
| InChIKey | HFQPXZJCDRYDIU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.29 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|