C12H18N2O6S — CID 61068031
2,3,4-trimethoxy-N-(2-sulfamoylethyl)benzamide (PubChem CID 61068031) has the molecular formula C12H18N2O6S and a molecular weight of 318.35 g/mol. Its IUPAC name is 2,3,4-trimethoxy-N-(2-sulfamoylethyl)benzamide.
| Compound Name | 2,3,4-trimethoxy-N-(2-sulfamoylethyl)benzamide |
|---|---|
| PubChem CID | 61068031 |
| Molecular Formula | C12H18N2O6S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 2,3,4-trimethoxy-N-(2-sulfamoylethyl)benzamide |
| SMILES | COc1ccc(C(=O)NCCS(N)(=O)=O)c(OC)c1OC |
| InChI | InChI=1S/C12H18N2O6S/c1-18-9-5-4-8(10(19-2)11(9)20-3)12(15)14-6-7-21(13,16)17/h4-5H,6-7H2,1-3H3,(H,14,15)(H2,13,16,17) |
| InChIKey | MOGPOCTUFGCBHN-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |